CAS
279261-81-3 Purity
98%
279261-81-3 Purity
98%
Inquiry Basket
2-(Propan-2-yloxy)naphthalene-1-boronic acid
CAS
1084904-39-1
Catalog Number
ACM1084904391
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C13H15BO3.
How much does the compound weigh?
The compound weighs 230.07 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is (2-propan-2-yloxynaphthalen-1-yl)boronic acid.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C13H15BO3/c1-9(2)17-12-8-7-10-5-3-4-6-11(10)13(12)14(15)16/h3-9,15-16H,1-2H3.
What is the InChIKey of the compound?
The InChIKey of the compound is YHVDICWVRLAXMV-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is B(C1=C(C=CC2=CC=CC=C12)OC(C)C)(O)O.
How many hydrogen bond donor counts does the compound have?
The compound has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does the compound have?
The compound has 3 hydrogen bond acceptor counts.
How many rotatable bond counts does the compound have?
The compound has 3 rotatable bond counts.
How many heavy atom counts does the compound have?
The compound has 17 heavy atom counts.
Recommended Products
