2-(Perfluorohexyl)ethyl methacrylate

CAS

2144-53-8

Catalog Number

ACM2144538

Category

Polymer/Macromolecule

Molecular Weight

432.18

Molecular Formula

C₁₂H₉F₁₃O₂

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

Specification

Synonyms

2-propenoicacid,2-methyl-,3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylester;2-(PERFLUOROHEXYL)ETHYL METHACRYLATE;3,3,4,4,5,5,6,6,7,7,8,8,8-TRIDECAFLUOROOCTYL METHACRYLATE;1H,1H,2H,2H-PERFLUOROOCTYL METHACRYLATE;Perfluorooctylmethacrylate;1H,1H,2H,2H-Perfl

What is the molecular formula of 2-(Perfluorohexyl)ethyl methacrylate?

The molecular formula of 2-(Perfluorohexyl)ethyl methacrylate is C12H9F13O2.

What is the molecular weight of 2-(Perfluorohexyl)ethyl methacrylate?

The molecular weight of 2-(Perfluorohexyl)ethyl methacrylate is 432.18 g/mol.

What is the IUPAC name of 2-(Perfluorohexyl)ethyl methacrylate?

The IUPAC name of 2-(Perfluorohexyl)ethyl methacrylate is 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl 2-methylprop-2-enoate.

What is the InChI of 2-(Perfluorohexyl)ethyl methacrylate?

The InChI of 2-(Perfluorohexyl)ethyl methacrylate is InChI=1S/C12H9F13O2/c1-5(2)6(26)27-4-3-7(13,14)8(15,16)9(17,18)10(19,20)11(21,22)12(23,24)25/h1,3-4H2,2H3.

What is the InChIKey of 2-(Perfluorohexyl)ethyl methacrylate?

The InChIKey of 2-(Perfluorohexyl)ethyl methacrylate is CDXFIRXEAJABAZ-UHFFFAOYSA-N.

What is the canonical SMILES of 2-(Perfluorohexyl)ethyl methacrylate?

The canonical SMILES of 2-(Perfluorohexyl)ethyl methacrylate is CC(=C)C(=O)OCCC(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F.

What is the CAS number of 2-(Perfluorohexyl)ethyl methacrylate?

The CAS number of 2-(Perfluorohexyl)ethyl methacrylate is 2144-53-8.

What is the UNII of 2-(Perfluorohexyl)ethyl methacrylate?

The UNII of 2-(Perfluorohexyl)ethyl methacrylate is A3INR94K4A.

What is the ChEMBL ID of 2-(Perfluorohexyl)ethyl methacrylate?

The ChEMBL ID of 2-(Perfluorohexyl)ethyl methacrylate is CHEMBL3183267.

What is the XLogP3-AA value of 2-(Perfluorohexyl)ethyl methacrylate?

The XLogP3-AA value of 2-(Perfluorohexyl)ethyl methacrylate is 5.9.