2-(N-Ethyl-N-m-toluidino)ethanol

• CAS: 91-88-3
• Catalog Number: ACM91883
• Category: Amino Alcohols
• Molecular Weight: 179.26
• Molecular Formula: C₁₁H₁₇NO
• Hazard Statements: H302-H315-H318-H335
• RIDADR: NONH for all modes of transport
• Symbol: GHS05

Custom Q&A

What is the molecular formula of 2-(N-Ethyl-N-m-toluidino)ethanol?

The molecular formula is C11H17NO.

What is the molecular weight of 2-(N-Ethyl-N-m-toluidino)ethanol?

The molecular weight is 179.26 g/mol.

What is the IUPAC name of 2-(N-Ethyl-N-m-toluidino)ethanol?

The IUPAC name is 2-(N-ethyl-3-methylanilino)ethanol.

What is the InChI of 2-(N-Ethyl-N-m-toluidino)ethanol?

The InChI is InChI=1S/C11H17NO/c1-3-12(7-8-13)11-6-4-5-10(2)9-11/h4-6,9,13H,3,7-8H2,1-2H3.

What is the InChIKey of 2-(N-Ethyl-N-m-toluidino)ethanol?

The InChIKey is KRNUKKZDGDAWBF-UHFFFAOYSA-N.

How many hydrogen bond donor count does 2-(N-Ethyl-N-m-toluidino)ethanol have?

It has 1 hydrogen bond donor count.

How many hydrogen bond acceptor count does 2-(N-Ethyl-N-m-toluidino)ethanol have?

It has 2 hydrogen bond acceptor count.

How many rotatable bond count does 2-(N-Ethyl-N-m-toluidino)ethanol have?

It has 4 rotatable bond count.

What is the topological polar surface area of 2-(N-Ethyl-N-m-toluidino)ethanol?

The topological polar surface area is 23.5Ų.

How many heavy atom count does 2-(N-Ethyl-N-m-toluidino)ethanol have?

It has 13 heavy atom count.