2-Methylthiophene-3-boronic acid pinacol ester

• CAS: 910553-12-7
• Catalog Number: ACM910553127
• Category: Boronic Esters
• Molecular Formula: C₁₁H₁₇BO₂S
• Synonyms: 4,4,5,5-Tetramethyl-2-(2-methyl-3-thienyl)-1,3,2-dioxaborolane;4,4,5,5-Tetramethyl-2-(2-methylthiophen-3-yl)-1,3,2-dioxaborolane

Custom Q&A

What is the molecular formula of 2-Methylthiophene-3-boronic acid pinacol ester?

The molecular formula is C11H17BO2S.

What is the molecular weight of 2-Methylthiophene-3-boronic acid pinacol ester?

The molecular weight is 224.13 g/mol.

What is the IUPAC name of 2-Methylthiophene-3-boronic acid pinacol ester?

The IUPAC name is 4,4,5,5-tetramethyl-2-(2-methylthiophen-3-yl)-1,3,2-dioxaborolane.

What is the InChI of 2-Methylthiophene-3-boronic acid pinacol ester?

The InChI is InChI=1S/C11H17BO2S/c1-8-9(6-7-15-8)12-13-10(2,3)11(4,5)14-12/h6-7H,1-5H3.

What is the InChIKey of 2-Methylthiophene-3-boronic acid pinacol ester?

The InChIKey is YCOQKTIMEQOYNN-UHFFFAOYSA-N.

What is the Canonical SMILES of 2-Methylthiophene-3-boronic acid pinacol ester?

The Canonical SMILES is B1(OC(C(O1)(C)C)(C)C)C2=C(SC=C2)C.

What is the CAS number of 2-Methylthiophene-3-boronic acid pinacol ester?

The CAS number is 910553-12-7.

How many hydrogen bond donor counts are there in 2-Methylthiophene-3-boronic acid pinacol ester?

There are 0 hydrogen bond donor counts.

What is the topological polar surface area of 2-Methylthiophene-3-boronic acid pinacol ester?

The topological polar surface area is 46.7 Ų.