2-Methoxy-6-ethylpyridine-5-boronicacid

• CAS: 848360-87-2
• Catalog Number: ACM848360872
• Category: Boro-Amino Acids
• Molecular Weight: 181.00
• Molecular Formula: C₈H₁₂BNO₃

Custom Q&A

What is the molecular formula of 2-Methoxy-6-ethylpyridine-5-boronicacid?

The molecular formula is C8H12BNO3.

What are some synonyms for 2-Methoxy-6-ethylpyridine-5-boronicacid?

Some synonyms include (2-Ethyl-6-methoxypyridin-3-yl)boronic acid and 6-METHOXY-2-ETHYLPYRIDINE-3-BORONIC ACID.

What is the molecular weight of 2-Methoxy-6-ethylpyridine-5-boronicacid?

The molecular weight is 181.00 g/mol.

What is the IUPAC name of 2-Methoxy-6-ethylpyridine-5-boronicacid?

The IUPAC name is (2-ethyl-6-methoxypyridin-3-yl)boronic acid.

What is the InChI of 2-Methoxy-6-ethylpyridine-5-boronicacid?

The InChI is InChI=1S/C8H12BNO3/c1-3-7-6(9(11)12)4-5-8(10-7)13-2/h4-5,11-12H,3H2,1-2H3.

What is the InChIKey of 2-Methoxy-6-ethylpyridine-5-boronicacid?

The InChIKey is MAOKCLBYGZDJNX-UHFFFAOYSA-N.

What is the canonical SMILES of 2-Methoxy-6-ethylpyridine-5-boronicacid?

The canonical SMILES is B(C1=C(N=C(C=C1)OC)CC)(O)O.

What is the CAS number of 2-Methoxy-6-ethylpyridine-5-boronicacid?

The CAS number is 848360-87-2.

What is the hydrogen bond donor count of 2-Methoxy-6-ethylpyridine-5-boronicacid?

The hydrogen bond donor count is 2.

Is 2-Methoxy-6-ethylpyridine-5-boronicacid a canonicalized compound?

Yes, 2-Methoxy-6-ethylpyridine-5-boronicacid is a canonicalized compound.