What is the molecular formula of 2-Methoxy-6,7,8,9-tetrahydro-benzocyclohepten-5-one?
The molecular formula is C12H14O2.
What is the molecular weight of 2-Methoxy-6,7,8,9-tetrahydro-benzocyclohepten-5-one?
The molecular weight is 190.24 g/mol.
What is the IUPAC name of 2-Methoxy-6,7,8,9-tetrahydro-benzocyclohepten-5-one?
The IUPAC name is 2-methoxy-6,7,8,9-tetrahydrobenzo[7]annulen-5-one.
What is the InChI of 2-Methoxy-6,7,8,9-tetrahydro-benzocyclohepten-5-one?
The InChI is InChI=1S/C12H14O2/c1-14-10-6-7-11-9(8-10)4-2-3-5-12(11)13/h6-8H,2-5H2,1H3.
What is the InChIKey of 2-Methoxy-6,7,8,9-tetrahydro-benzocyclohepten-5-one?
The InChIKey is WLRMIOGKWITDNU-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Methoxy-6,7,8,9-tetrahydro-benzocyclohepten-5-one?
The canonical SMILES is COC1=CC2=C(C=C1)C(=O)CCCC2.
What is the CAS number of 2-Methoxy-6,7,8,9-tetrahydro-benzocyclohepten-5-one?
The CAS number is 6500-65-8.
What is the EC number of 2-Methoxy-6,7,8,9-tetrahydro-benzocyclohepten-5-one?
The EC number is 676-161-1.
What is the DSSTox Substance ID of 2-Methoxy-6,7,8,9-tetrahydro-benzocyclohepten-5-one?
The DSSTox Substance ID is DTXSID10295809.
Is 2-Methoxy-6,7,8,9-tetrahydro-benzocyclohepten-5-one a canonicalized compound?
Yes, it is a canonicalized compound.