2-Hydroxy-N-(4-methoxyphenyl)-11H-benzo[a]carbazole-3-carboxamide

• CAS: 86-19-1
• Catalog Number: ACM86191
• Category: Azoic Dyes
• Molecular Weight: 382.41
• Molecular Formula: C₂₄H₁₈N₂O₃
• Synonyms: Azoic Coupling Component 13;2-Hydroxy-N-(4-methoxyphenyl)-11H-benzo[a]carbazole-3-carboxamide;Naphthol AS-SG

Custom Q&A

What is the molecular formula of the compound?

The molecular formula is C24H18N2O3.

What is the molecular weight of the compound?

The molecular weight is 382.4 g/mol.

What is the IUPAC name of the compound?

The IUPAC name is 2-hydroxy-N-(4-methoxyphenyl)-11H-benzo[a]carbazole-3-carboxamide.

What is the InChI of the compound?

The InChI is InChI=1S/C24H18N2O3/c1-29-16-9-7-15(8-10-16)25-24(28)20-12-14-6-11-18-17-4-2-3-5-21(17)26-23(18)19(14)13-22(20)27/h2-13,26-27H,1H3,(H,25,28).

What is the InChIKey of the compound?

The InChIKey is HRNSEOMPRWUKQL-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES is COC1=CC=C(C=C1)NC(=O)C2=C(C=C3C(=C2)C=CC4=C3NC5=CC=CC=C45)O.

What is the CAS number of the compound?

The CAS number is 86-19-1.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value is 5.6.

How many hydrogen bond donor counts does the compound have?

The compound has 3 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does the compound have?

The compound has 3 hydrogen bond acceptor counts.