2-Hydroxy-4-(2-hydroxyethoxy)benzoic acid

• Catalog Number: ACMA00002882
• Category: Ethers
• Molecular Weight: 198.17
• Molecular Formula: C₉H₁₀O₃
• Hazard Statements: H302
• RIDADR: UN 3265 8 / PGII
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 2-Hydroxy-4-(2-hydroxyethoxy)benzoic acid?

The molecular formula is C9H10O5.

What is the molecular weight of 2-Hydroxy-4-(2-hydroxyethoxy)benzoic acid?

The molecular weight is 198.17 g/mol.

What is the IUPAC name of 2-Hydroxy-4-(2-hydroxyethoxy)benzoic acid?

The IUPAC name is 2-hydroxy-4-(2-hydroxyethoxy)benzoic acid.

What is the InChI of 2-Hydroxy-4-(2-hydroxyethoxy)benzoic acid?

The InChI is InChI=1S/C9H10O5/c10-3-4-14-6-1-2-7(9(12)13)8(11)5-6/h1-2,5,10-11H,3-4H2,(H,12,13).

What is the InChIKey of 2-Hydroxy-4-(2-hydroxyethoxy)benzoic acid?

The InChIKey is INEIMLMPQGJCGK-UHFFFAOYSA-N.

What is the CAS number of 2-Hydroxy-4-(2-hydroxyethoxy)benzoic acid?

The CAS number is 163451-82-9.

What is the XLogP3 value of 2-Hydroxy-4-(2-hydroxyethoxy)benzoic acid?

The XLogP3 value is 1.3.

How many hydrogen bond donor counts does 2-Hydroxy-4-(2-hydroxyethoxy)benzoic acid have?

It has 3 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 2-Hydroxy-4-(2-hydroxyethoxy)benzoic acid have?

It has 5 hydrogen bond acceptor counts.

How many rotatable bond counts does 2-Hydroxy-4-(2-hydroxyethoxy)benzoic acid have?

It has 4 rotatable bond counts.