CAS
5689-23-6 Purity
---
5689-23-6 Purity
---
Inquiry Basket
2-Hydroxy-3-butynoic acid
Catalog Number
ACMA00000428
Category
Alcohols
Molecular Weight
100.07
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H302 + H332-H311-H350-H361-H412
RIDADR
NONH for all modes of transport
Symbol
GHS06
What is the molecular formula of 2-Hydroxy-3-butynoic acid?
The molecular formula of 2-Hydroxy-3-butynoic acid is C4H4O3.
What is the molecular weight of 2-Hydroxy-3-butynoic acid?
The molecular weight of 2-Hydroxy-3-butynoic acid is 100.07 g/mol.
What is the IUPAC name of 2-Hydroxy-3-butynoic acid?
The IUPAC name of 2-Hydroxy-3-butynoic acid is 2-hydroxybut-3-ynoic acid.
What is the InChI of 2-Hydroxy-3-butynoic acid?
The InChI of 2-Hydroxy-3-butynoic acid is InChI=1S/C4H4O3/c1-2-3(5)4(6)7/h1,3,5H,(H,6,7).
What is the InChIKey of 2-Hydroxy-3-butynoic acid?
The InChIKey of 2-Hydroxy-3-butynoic acid is LWNHDEQKHFRYMD-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Hydroxy-3-butynoic acid?
The canonical SMILES of 2-Hydroxy-3-butynoic acid is C#CC(C(=O)O)O.
What is the CAS number of 2-Hydroxy-3-butynoic acid?
The CAS number of 2-Hydroxy-3-butynoic acid is 40027-75-6.
How many hydrogen bond donor counts does 2-Hydroxy-3-butynoic acid have?
2-Hydroxy-3-butynoic acid has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2-Hydroxy-3-butynoic acid have?
2-Hydroxy-3-butynoic acid has 3 hydrogen bond acceptor counts.
Recommended Products
