What is the molecular formula of 2-Fluoro-5-(methoxycarbamoyl)phenylboronic acid?
The molecular formula is C8H9BFNO4.
What is the molecular weight of 2-Fluoro-5-(methoxycarbamoyl)phenylboronic acid?
The molecular weight is 212.97 g/mol.
What is the IUPAC name of 2-Fluoro-5-(methoxycarbamoyl)phenylboronic acid?
The IUPAC name is [2-fluoro-5-(methoxycarbamoyl)phenyl]boronic acid.
What is the InChI of 2-Fluoro-5-(methoxycarbamoyl)phenylboronic acid?
The InChI is InChI=1S/C8H9BFNO4/c1-15-11-8(12)5-2-3-7(10)6(4-5)9(13)14/h2-4,13-14H,1H3,(H,11,12).
What is the InChIKey of 2-Fluoro-5-(methoxycarbamoyl)phenylboronic acid?
The InChIKey is BICVNGATAFRLPE-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Fluoro-5-(methoxycarbamoyl)phenylboronic acid?
The canonical SMILES is B(C1=C(C=CC(=C1)C(=O)NOC)F)(O)O.
What is the CAS number of 2-Fluoro-5-(methoxycarbamoyl)phenylboronic acid?
The CAS number is 874289-58-4.
What is the EC number of 2-Fluoro-5-(methoxycarbamoyl)phenylboronic acid?
The EC number is 688-425-3.
What is the hydrogen bond donor count of 2-Fluoro-5-(methoxycarbamoyl)phenylboronic acid?
The hydrogen bond donor count is 3.
What is the defined bond stereocenter count of 2-Fluoro-5-(methoxycarbamoyl)phenylboronic acid?
The defined bond stereocenter count is 0.