2-Ethynyl-6-methoxynaphthalene

• CAS: 129113-00-4
• Catalog Number: ACM129113004-1
• Category: Alkynes
• Molecular Weight: 182.22
• Hazard Statements: H315-H319-H335
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 2-Ethynyl-6-methoxynaphthalene?

The molecular formula is C13H10O.

What is the molecular weight of 2-Ethynyl-6-methoxynaphthalene?

The molecular weight is 182.22 g/mol.

What is the IUPAC name of 2-Ethynyl-6-methoxynaphthalene?

The IUPAC name is 2-ethynyl-6-methoxynaphthalene.

What is the InChI of 2-Ethynyl-6-methoxynaphthalene?

The InChI is InChI=1S/C13H10O/c1-3-10-4-5-12-9-13(14-2)7-6-11(12)8-10/h1,4-9H,2H3.

What is the InChIKey of 2-Ethynyl-6-methoxynaphthalene?

The InChIKey is PATPLTUFXUXNDY-UHFFFAOYSA-N.

What is the canonical SMILES of 2-Ethynyl-6-methoxynaphthalene?

The canonical SMILES is COC1=CC2=C(C=C1)C=C(C=C2)C#C.

What is the CAS number of 2-Ethynyl-6-methoxynaphthalene?

The CAS number is 129113-00-4.

What is the XLogP3 value of 2-Ethynyl-6-methoxynaphthalene?

The XLogP3 value is 3.4.

How many hydrogen bond donor counts does 2-Ethynyl-6-methoxynaphthalene have?

It has 0 hydrogen bond donor count.

How many hydrogen bond acceptor counts does 2-Ethynyl-6-methoxynaphthalene have?

It has 1 hydrogen bond acceptor count.