2-Ethylhexyl 4-amino-3,5,6-trichloro-pyridine-2-carboxylate

• CAS: 36374-99-9
• Catalog Number: ACM36374999
• Category: Main Products
• Molecular Weight: 0
• Molecular Formula: C₁₄H₁₉Cl₃N₂O₂
• Synonyms: 2-ethylhexyl 4-amino-3,5,6-trichloro-pyridine-2-carboxylate;PICLORAM2-ETHYLHEXYLESTER

Custom Q&A

What is the molecular formula of 2-Ethylhexyl 4-amino-3,5,6-trichloropyridine-2-carboxylate?

The molecular formula is C14H19Cl3N2O2.

What is the molecular weight of 2-Ethylhexyl 4-amino-3,5,6-trichloropyridine-2-carboxylate?

The molecular weight is 353.7 g/mol.

What is the IUPAC name of 2-Ethylhexyl 4-amino-3,5,6-trichloropyridine-2-carboxylate?

The IUPAC name is 2-ethylhexyl 4-amino-3,5,6-trichloropyridine-2-carboxylate.

What is the InChI of 2-Ethylhexyl 4-amino-3,5,6-trichloropyridine-2-carboxylate?

The InChI is InChI=1S/C14H19Cl3N2O2/c1-3-5-6-8(4-2)7-21-14(20)12-9(15)11(18)10(16)13(17)19-12/h8H,3-7H2,1-2H3,(H2,18,19).

What is the InChIKey of 2-Ethylhexyl 4-amino-3,5,6-trichloropyridine-2-carboxylate?

The InChIKey is RPDJBUSVCYFTRU-UHFFFAOYSA-N.

What is the canonical SMILES representation of 2-Ethylhexyl 4-amino-3,5,6-trichloropyridine-2-carboxylate?

The canonical SMILES representation is CCCC(CCC)COC(=O)C1=NC(=C(C(=C1Cl)N)Cl)Cl.

What is the CAS number of 2-Ethylhexyl 4-amino-3,5,6-trichloropyridine-2-carboxylate?

The CAS number is 36374-99-9.

What is the XLogP3-AA value of 2-Ethylhexyl 4-amino-3,5,6-trichloropyridine-2-carboxylate?

The XLogP3-AA value is 5.7.

How many hydrogen bond donor counts are there in 2-Ethylhexyl 4-amino-3,5,6-trichloropyridine-2-carboxylate?

There is 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts are there in 2-Ethylhexyl 4-amino-3,5,6-trichloropyridine-2-carboxylate?

There are 4 hydrogen bond acceptor counts.