(2-Ethoxypropyl)methylamine

• CAS: 883538-59-8
• Catalog Number: ACM883538598
• Category: Ethers
• Molecular Weight: 117.19
• Molecular Formula: C₆H₁₂O₅
• Hazard Statements: H319
• RIDADR: UN 3271 3 / PGII
• Symbol: GHS07

Custom Q&A

What is the IUPAC name of the compound?

The IUPAC name of the compound is 2-ethoxy-N-methylpropan-1-amine.

What is the molecular formula of the compound?

The molecular formula of the compound is C6H15NO.

What is the molecular weight of the compound?

The molecular weight of the compound is 117.19 g/mol.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C6H15NO/c1-4-8-6(2)5-7-3/h6-7H,4-5H2,1-3H3.

What is the InChIKey of the compound?

The InChIKey of the compound is KJTUSBFXQJSKIW-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is CCOC(C)CNC.

What is the CAS number of the compound?

The CAS number of the compound is 883538-59-8.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 0.4.

How many hydrogen bond donor counts does the compound have?

The compound has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does the compound have?

The compound has 2 hydrogen bond acceptor counts.