2-Ethoxy-4-fluorobenzaldehyde

• Catalog Number: ACMA00002920
• Category: Ethers
• Molecular Weight: 168.16
• Molecular Formula: C₉H₉BrO₃
• Hazard Statements: H302
• RIDADR: UN 2811 6.1 / PGIII
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 2-Ethoxy-4-fluorobenzaldehyde?

The molecular formula is C9H9FO2.

What is the molecular weight of 2-Ethoxy-4-fluorobenzaldehyde?

The molecular weight is 168.16 g/mol.

What is the IUPAC name of 2-Ethoxy-4-fluorobenzaldehyde?

The IUPAC name is 2-ethoxy-4-fluorobenzaldehyde.

What is the InChI of 2-Ethoxy-4-fluorobenzaldehyde?

The InChI is InChI=1S/C9H9FO2/c1-2-12-9-5-8(10)4-3-7(9)6-11/h3-6H,2H2,1H3.

What is the InChIKey of 2-Ethoxy-4-fluorobenzaldehyde?

The InChIKey is AFNWRNDORVJZIM-UHFFFAOYSA-N.

What is the Canonical SMILES of 2-Ethoxy-4-fluorobenzaldehyde?

The Canonical SMILES is CCOC1=C(C=CC(=C1)F)C=O.

What is the XLogP3-AA value of 2-Ethoxy-4-fluorobenzaldehyde?

The XLogP3-AA value is 1.8.

How many hydrogen bond donor counts does 2-Ethoxy-4-fluorobenzaldehyde have?

It has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 2-Ethoxy-4-fluorobenzaldehyde have?

It has 3 hydrogen bond acceptor counts.

How many rotatable bond counts does 2-Ethoxy-4-fluorobenzaldehyde have?

It has 3 rotatable bond counts.