2-Dodecen-1-ylsuccinic anhydride

• CAS: 19780-11-1
• Catalog Number: ACM19780111
• Category: Polymer/Macromolecule
• Molecular Weight: 266.38
• Molecular Formula: C₁₆H₂₆O₃
• Synonyms: 2,5-Furandione, 3-(2-dodecenyl)dihydro-;2,5-Furandione, 3-dodecenyl-;3-(2-dodecenyl)dihydro-5-furandione;3-[(2E)-2-Dodecenyl]dihydro-2,5-furandione;TETRAPROPENYLSUCCINIC ANHYDRIDE;TPSA;J-12;DDSA

Custom Q&A

What is the molecular formula of 2-Dodecen-1-ylsuccinic anhydride?

The molecular formula is C16H26O3.

What is the molecular weight of 2-Dodecen-1-ylsuccinic anhydride?

The molecular weight is 266.38 g/mol.

What is the IUPAC name of 2-Dodecen-1-ylsuccinic anhydride?

The IUPAC name is 3-[(E)-dodec-2-enyl]oxolane-2,5-dione.

What is the InChI of 2-Dodecen-1-ylsuccinic anhydride?

The InChI is InChI=1S/C16H26O3/c1-2-3-4-5-6-7-8-9-10-11-12-14-13-15(17)19-16(14)18/h10-11,14H,2-9,12-13H2,1H3/b11-10+.

What is the canonical SMILES of 2-Dodecen-1-ylsuccinic anhydride?

The canonical SMILES is CCCCCCCCCC=CCC1CC(=O)OC1=O.

What is the isomeric SMILES of 2-Dodecen-1-ylsuccinic anhydride?

The isomeric SMILES is CCCCCCCCC/C=C/CC1CC(=O)OC1=O.

What is the CAS number of 2-Dodecen-1-ylsuccinic anhydride?

The CAS number is 19780-11-1.

What is the UNII of 2-Dodecen-1-ylsuccinic anhydride?

The UNII is S63TTA7G5P.

What is the XLogP3-AA value of 2-Dodecen-1-ylsuccinic anhydride?

The XLogP3-AA value is 5.1.

What is the topological polar surface area of 2-Dodecen-1-ylsuccinic anhydride?

The topological polar surface area is 43.4Ų.