[2-(Cyclopentyloxy)phenyl]methanamine

• Catalog Number: ACMA00002236
• Category: Ethers
• Molecular Weight: 191.27
• Molecular Formula: C₁₂H₁₆O₃
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of [2-(Cyclopentyloxy)phenyl]methanamine?

The molecular formula is C12H17NO.

What is the molecular weight of [2-(Cyclopentyloxy)phenyl]methanamine?

The molecular weight is 191.27 g/mol.

What is the IUPAC name of [2-(Cyclopentyloxy)phenyl]methanamine?

The IUPAC name is (2-cyclopentyloxyphenyl)methanamine.

What is the InChI of [2-(Cyclopentyloxy)phenyl]methanamine?

The InChI is InChI=1S/C12H17NO/c13-9-10-5-1-4-8-12(10)14-11-6-2-3-7-11/h1,4-5,8,11H,2-3,6-7,9,13H2.

What is the InChIKey of [2-(Cyclopentyloxy)phenyl]methanamine?

The InChIKey is NYCBHEMCYMXECF-UHFFFAOYSA-N.

What is the canonical SMILES of [2-(Cyclopentyloxy)phenyl]methanamine?

The canonical SMILES is C1CCC(C1)OC2=CC=CC=C2CN.

What is the CAS number of [2-(Cyclopentyloxy)phenyl]methanamine?

The CAS number is 943117-99-5.

What is the European Community (EC) Number of [2-(Cyclopentyloxy)phenyl]methanamine?

The EC number is 845-538-4.

What is the XLogP3-AA value of [2-(Cyclopentyloxy)phenyl]methanamine?

The XLogP3-AA value is 2.

Is the compound [2-(Cyclopentyloxy)phenyl]methanamine canonicalized?

Yes, the compound is canonicalized.