CAS
1310404-02-4 Purity
---
1310404-02-4 Purity
---
Inquiry Basket
2-Chloro-5-(trifluoromethyl)pyridine-4-boronic acid
CAS
1167437-28-6
Catalog Number
ACM1167437286
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Chloro-5-(trifluoromethyl)pyridine-4-boronic acid?
The molecular formula of 2-Chloro-5-(trifluoromethyl)pyridine-4-boronic acid is C6H4BClF3NO2.
What is the molecular weight of 2-Chloro-5-(trifluoromethyl)pyridine-4-boronic acid?
The molecular weight of 2-Chloro-5-(trifluoromethyl)pyridine-4-boronic acid is 225.36 g/mol.
What is the IUPAC name of 2-Chloro-5-(trifluoromethyl)pyridine-4-boronic acid?
The IUPAC name of 2-Chloro-5-(trifluoromethyl)pyridine-4-boronic acid is [2-chloro-5-(trifluoromethyl)pyridin-4-yl]boronic acid.
What is the InChI of 2-Chloro-5-(trifluoromethyl)pyridine-4-boronic acid?
The InChI of 2-Chloro-5-(trifluoromethyl)pyridine-4-boronic acid is InChI=1S/C6H4BClF3NO2/c8-5-1-4(7(13)14)3(2-12-5)6(9,10)11/h1-2,13-14H.
What is the InChIKey of 2-Chloro-5-(trifluoromethyl)pyridine-4-boronic acid?
The InChIKey of 2-Chloro-5-(trifluoromethyl)pyridine-4-boronic acid is GBNMDZQANRHEDY-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Chloro-5-(trifluoromethyl)pyridine-4-boronic acid?
The canonical SMILES of 2-Chloro-5-(trifluoromethyl)pyridine-4-boronic acid is B(C1=CC(=NC=C1C(F)(F)F)Cl)(O)O.
What is the CAS number of 2-Chloro-5-(trifluoromethyl)pyridine-4-boronic acid?
The CAS number of 2-Chloro-5-(trifluoromethyl)pyridine-4-boronic acid is 1167437-28-6.
How many hydrogen bond donor counts are there in 2-Chloro-5-(trifluoromethyl)pyridine-4-boronic acid?
There are 2 hydrogen bond donor counts in 2-Chloro-5-(trifluoromethyl)pyridine-4-boronic acid.
How many hydrogen bond acceptor counts are there in 2-Chloro-5-(trifluoromethyl)pyridine-4-boronic acid?
There are 6 hydrogen bond acceptor counts in 2-Chloro-5-(trifluoromethyl)pyridine-4-boronic acid.
How many rotatable bond counts are there in 2-Chloro-5-(trifluoromethyl)pyridine-4-boronic acid?
There is 1 rotatable bond count in 2-Chloro-5-(trifluoromethyl)pyridine-4-boronic acid.
Recommended Products
![Benzo[c]isothiazol-5-ylboronic acid](https://resource.alfa-chemistry.com/structure/1310404-02-4.gif)
