CAS
1072944-13-8 Purity
---
1072944-13-8 Purity
---
Inquiry Basket
2-Chloro-5-fluoro-3-methylpyridine-4-boronicacid
CAS
1072944-10-5
Catalog Number
ACM1072944105
Category
Boro-Amino Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the IUPAC name of the compound?
The IUPAC name of the compound is (2-chloro-5-fluoro-3-methylpyridin-4-yl)boronic acid.
What is the molecular weight of the compound?
The molecular weight of the compound is 189.38 g/mol.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C6H6BClFNO2/c1-3-5(7(11)12)4(9)2-10-6(3)8/h2,11-12H,1H3.
What is the InChIKey of the compound?
The InChIKey of the compound is FTDOMJJSIAKGIB-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is B(C1=C(C(=NC=C1F)Cl)C)(O)O.
What is the CAS number of the compound?
The CAS number of the compound is 1072944-10-5.
What is the EPA DSSTox Substance ID of the compound?
The EPA DSSTox Substance ID of the compound is DTXSID00660547.
How many hydrogen bond donor counts does the compound have?
The compound has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does the compound have?
The compound has 4 hydrogen bond acceptor counts.
Recommended Products
