2-Chloro-4-(trifluoromethyl)aniline

• CAS: 39885-50-2
• Catalog Number: ACM39885502
• Category: Alkyl Fluorinated Building Blocks
• Molecular Weight: 195.57
• Molecular Formula: C₃H₅FO₂
• Hazard Statements: H226-H314-H331
• RIDADR: UN 2810 6.1 / PGIII
• Symbol: GHS02

Custom Q&A

What is the molecular formula of 2-Chloro-4-(trifluoromethyl)aniline?

The molecular formula of 2-Chloro-4-(trifluoromethyl)aniline is C7H5ClF3N.

What is the molecular weight of 2-Chloro-4-(trifluoromethyl)aniline?

The molecular weight of 2-Chloro-4-(trifluoromethyl)aniline is 195.57 g/mol.

What are some synonyms for 2-Chloro-4-(trifluoromethyl)aniline?

Some synonyms for 2-Chloro-4-(trifluoromethyl)aniline are 4-Amino-3-chlorobenzotrifluoride and 2-Chloro-4-trifluoromethylaniline.

What is the InChIKey for 2-Chloro-4-(trifluoromethyl)aniline?

The InChIKey for 2-Chloro-4-(trifluoromethyl)aniline is MBBUTABXEITVNY-UHFFFAOYSA-N.

What is the canonical SMILES representation of 2-Chloro-4-(trifluoromethyl)aniline?

The canonical SMILES representation of 2-Chloro-4-(trifluoromethyl)aniline is C1=CC(=C(C=C1C(F)(F)F)Cl)N.

What is the XLogP3 value of 2-Chloro-4-(trifluoromethyl)aniline?

The XLogP3 value of 2-Chloro-4-(trifluoromethyl)aniline is 3.1.

How many hydrogen bond acceptor counts does 2-Chloro-4-(trifluoromethyl)aniline have?

2-Chloro-4-(trifluoromethyl)aniline has 4 hydrogen bond acceptor counts.

What is the topological polar surface area of 2-Chloro-4-(trifluoromethyl)aniline?

The topological polar surface area of 2-Chloro-4-(trifluoromethyl)aniline is 26 Ų.

How many rotatable bond counts does 2-Chloro-4-(trifluoromethyl)aniline have?

2-Chloro-4-(trifluoromethyl)aniline has 0 rotatable bond counts.

What is the complexity value of 2-Chloro-4-(trifluoromethyl)aniline?

The complexity value of 2-Chloro-4-(trifluoromethyl)aniline is 159.