913835-88-8 Purity
98%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 2-Chloro-4-(ethoxycarbonyl)phenylboronic acid is C9H10BClO4.
The molecular weight of 2-Chloro-4-(ethoxycarbonyl)phenylboronic acid is 228.44 g/mol.
The IUPAC name of 2-Chloro-4-(ethoxycarbonyl)phenylboronic acid is (2-chloro-4-ethoxycarbonylphenyl)boronic acid.
The InChI code of 2-Chloro-4-(ethoxycarbonyl)phenylboronic acid is InChI=1S/C9H10BClO4/c1-2-15-9(12)6-3-4-7(10(13)14)8(11)5-6/h3-5,13-14H,2H2,1H3.
The InChIKey of 2-Chloro-4-(ethoxycarbonyl)phenylboronic acid is JVVJLOYYNCABND-UHFFFAOYSA-N.
The canonical SMILES of 2-Chloro-4-(ethoxycarbonyl)phenylboronic acid is B(C1=C(C=C(C=C1)C(=O)OCC)Cl)(O)O.
The CAS number of 2-Chloro-4-(ethoxycarbonyl)phenylboronic acid is 913835-94-6.
The hydrogen bond donor count of 2-Chloro-4-(ethoxycarbonyl)phenylboronic acid is 2.
The hydrogen bond acceptor count of 2-Chloro-4-(ethoxycarbonyl)phenylboronic acid is 4.
The topological polar surface area of 2-Chloro-4-(ethoxycarbonyl)phenylboronic acid is 66.8Ų.