2-Chloro-3-iodo-6-(trifluoromethyl)pyridine

• CAS: 205240-59-1
• Catalog Number: ACM205240591
• Category: Pyridines
• Molecular Weight: 307.44
• Molecular Formula: C6H2ClF3IN
• Synonyms: Pyridine, 2-chloro-3-iodo-6-(trifluoromethyl)-

Custom Q&A

What is the molecular formula of 2-Chloro-3-iodo-6-(trifluoromethyl)pyridine?

The molecular formula is C6H2ClF3IN.

What is the molecular weight of 2-Chloro-3-iodo-6-(trifluoromethyl)pyridine?

The molecular weight is 307.44 g/mol.

What is the IUPAC name of 2-Chloro-3-iodo-6-(trifluoromethyl)pyridine?

The IUPAC name is 2-chloro-3-iodo-6-(trifluoromethyl)pyridine.

What is the InChI of 2-Chloro-3-iodo-6-(trifluoromethyl)pyridine?

The InChI is InChI=1S/C6H2ClF3IN/c7-5-3(11)1-2-4(12-5)6(8,9)10/h1-2H.

What is the Canonical SMILES of 2-Chloro-3-iodo-6-(trifluoromethyl)pyridine?

The Canonical SMILES is C1=CC(=NC(=C1I)Cl)C(F)(F)F.

What is the CAS number for 2-Chloro-3-iodo-6-(trifluoromethyl)pyridine?

The CAS number is 205240-59-1.

What is the XLogP3-AA value of 2-Chloro-3-iodo-6-(trifluoromethyl)pyridine?

The XLogP3-AA value is 3.4.

How many hydrogen bond acceptors are there in 2-Chloro-3-iodo-6-(trifluoromethyl)pyridine?

There are 4 hydrogen bond acceptors.

What is the topological polar surface area of 2-Chloro-3-iodo-6-(trifluoromethyl)pyridine?

The topological polar surface area is 12.9 Ų.

Is 2-Chloro-3-iodo-6-(trifluoromethyl)pyridine a canonicalized compound?

Yes, it is a canonicalized compound.