CAS
1310384-86-1 Purity
---
1310384-86-1 Purity
---
Inquiry Basket
2-Chloro-3-fluoropyridine-5-boronicacid
CAS
1072946-66-7
Catalog Number
ACM1072946667-1
Category
Boro-Amino Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Chloro-3-fluoropyridine-5-boronic acid?
The molecular formula of 2-Chloro-3-fluoropyridine-5-boronic acid is C5H4BClFNO2.
What is the molecular weight of 2-Chloro-3-fluoropyridine-5-boronic acid?
The molecular weight of 2-Chloro-3-fluoropyridine-5-boronic acid is 175.35 g/mol.
What is the IUPAC name of 2-Chloro-3-fluoropyridine-5-boronic acid?
The IUPAC name of 2-Chloro-3-fluoropyridine-5-boronic acid is (6-chloro-5-fluoropyridin-3-yl)boronic acid.
What is the InChI of 2-Chloro-3-fluoropyridine-5-boronic acid?
The InChI of 2-Chloro-3-fluoropyridine-5-boronic acid is InChI=1S/C5H4BClFNO2/c7-5-4(8)1-3(2-9-5)6(10)11/h1-2,10-11H.
What is the InChIKey of 2-Chloro-3-fluoropyridine-5-boronic acid?
The InChIKey of 2-Chloro-3-fluoropyridine-5-boronic acid is NWEKVQKALFWZHQ-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Chloro-3-fluoropyridine-5-boronic acid?
The canonical SMILES of 2-Chloro-3-fluoropyridine-5-boronic acid is B(C1=CC(=C(N=C1)Cl)F)(O)O.
What is the CAS number of 2-Chloro-3-fluoropyridine-5-boronic acid?
The CAS number of 2-Chloro-3-fluoropyridine-5-boronic acid is 1072946-66-7.
How many hydrogen bond donor counts are there in 2-Chloro-3-fluoropyridine-5-boronic acid?
There are 2 hydrogen bond donor counts in 2-Chloro-3-fluoropyridine-5-boronic acid.
How many rotatable bond counts are there in 2-Chloro-3-fluoropyridine-5-boronic acid?
There is 1 rotatable bond count in 2-Chloro-3-fluoropyridine-5-boronic acid.
Recommended Products
