2-Butylcyclohexanone

• CAS: 1126-18-7
• Catalog Number: ACM1126187
• Category: Other Products
• Molecular Weight: 0
• Molecular Formula: C₁₀H₁₈O

Custom Q&A

What is the IUPAC name of the compound 2-Butylcyclohexanone?

The IUPAC name of the compound is 2-butylcyclohexan-1-one.

What is the molecular formula of 2-Butylcyclohexanone?

The molecular formula of 2-Butylcyclohexanone is C10H18O.

What is the molecular weight of 2-Butylcyclohexanone?

The molecular weight of 2-Butylcyclohexanone is 154.25 g/mol.

What is the CAS number of 2-Butylcyclohexanone?

The CAS number of 2-Butylcyclohexanone is 1126-18-7.

What is the InChI of 2-Butylcyclohexanone?

The InChI of 2-Butylcyclohexanone is InChI=1S/C10H18O/c1-2-3-6-9-7-4-5-8-10(9)11/h9H,2-8H2,1H3.

What is the InChIKey of 2-Butylcyclohexanone?

The InChIKey of 2-Butylcyclohexanone is POYYYXPQBFPUKS-UHFFFAOYSA-N.

How many hydrogen bond donor counts does 2-Butylcyclohexanone have?

2-Butylcyclohexanone has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 2-Butylcyclohexanone have?

2-Butylcyclohexanone has 1 hydrogen bond acceptor count.

What is the topological polar surface area of 2-Butylcyclohexanone?

The topological polar surface area of 2-Butylcyclohexanone is 17.1 ?2.

How many rotatable bond counts does 2-Butylcyclohexanone have?

2-Butylcyclohexanone has 3 rotatable bond counts.