CAS
54016-70-5 Purity
---
54016-70-5 Purity
---
Inquiry Basket
2-Bromo-7-chloroquinoxaline
CAS
89891-64-5
Catalog Number
ACM89891645
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Bromo-7-chloroquinoxaline?
The molecular formula of 2-Bromo-7-chloroquinoxaline is C8H4BrClN2.
What is the molecular weight of 2-Bromo-7-chloroquinoxaline?
The molecular weight of 2-Bromo-7-chloroquinoxaline is 243.49 g/mol.
What is the IUPAC name of 2-Bromo-7-chloroquinoxaline?
The IUPAC name of 2-Bromo-7-chloroquinoxaline is 2-bromo-7-chloroquinoxaline.
What is the InChI of 2-Bromo-7-chloroquinoxaline?
The InChI of 2-Bromo-7-chloroquinoxaline is InChI=1S/C8H4BrClN2/c9-8-4-11-6-2-1-5(10)3-7(6)12-8/h1-4H.
What is the InChIKey of 2-Bromo-7-chloroquinoxaline?
The InChIKey of 2-Bromo-7-chloroquinoxaline is FEXDKBKBNHCTDC-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-7-chloroquinoxaline?
The canonical SMILES of 2-Bromo-7-chloroquinoxaline is C1=CC2=NC=C(N=C2C=C1Cl)Br.
What is the CAS number of 2-Bromo-7-chloroquinoxaline?
The CAS number of 2-Bromo-7-chloroquinoxaline is 89891-64-5.
What is the hydrogen bond donor count of 2-Bromo-7-chloroquinoxaline?
The hydrogen bond donor count of 2-Bromo-7-chloroquinoxaline is 0.
What is the hydrogen bond acceptor count of 2-Bromo-7-chloroquinoxaline?
The hydrogen bond acceptor count of 2-Bromo-7-chloroquinoxaline is 2.
Is 2-Bromo-7-chloroquinoxaline a canonicalized compound?
Yes, 2-Bromo-7-chloroquinoxaline is a canonicalized compound.
Recommended Products
