What is the molecular formula of 2-Bromo-6-(trifluoromethyl)pyridine?
The molecular formula is C6H3BrF3N.
When was the PubChem CID for 2-Bromo-6-(trifluoromethyl)pyridine created and last modified?
The CID was created on 2005-07-19 and last modified on 2023-12-02.
What is the IUPAC name of 2-Bromo-6-(trifluoromethyl)pyridine?
The IUPAC name is 2-bromo-6-(trifluoromethyl)pyridine.
What is the InChIKey of 2-Bromo-6-(trifluoromethyl)pyridine?
The InChIKey is DOWNSQADAFSSAR-UHFFFAOYSA-N.
What is the Canonical SMILES representation of 2-Bromo-6-(trifluoromethyl)pyridine?
The Canonical SMILES is C1=CC(=NC(=C1)Br)C(F)(F)F.
What is the molecular weight of 2-Bromo-6-(trifluoromethyl)pyridine?
The molecular weight is 225.99 g/mol.
How many hydrogen bond acceptors are there in 2-Bromo-6-(trifluoromethyl)pyridine?
There are four hydrogen bond acceptors in the compound.
What is the topological polar surface area of 2-Bromo-6-(trifluoromethyl)pyridine?
The topological polar surface area is 12.9Ų.
How many defined atom stereocenters are present in 2-Bromo-6-(trifluoromethyl)pyridine?
There are zero defined atom stereocenters in the compound.
Is 2-Bromo-6-(trifluoromethyl)pyridine a canonicalized compound?
Yes, the compound is canonicalized according to PubChem.