2-Bromo-6-iodopyridin-3-ol

• CAS: 129611-32-1
• Catalog Number: ACM129611321-1
• Category: Pyridines
• Molecular Weight: 299.89
• Molecular Formula: C5H3BrINO
• Synonyms: 2-Bromo-3-hydroxy-6-iodopyridine
• Appearance: Solid

Custom Q&A

What is the molecular formula of 2-Bromo-6-iodopyridin-3-ol?

The molecular formula of 2-Bromo-6-iodopyridin-3-ol is C5H3BrINO.

What is the molecular weight of 2-Bromo-6-iodopyridin-3-ol?

The molecular weight of 2-Bromo-6-iodopyridin-3-ol is 299.89 g/mol.

What is the IUPAC name of 2-Bromo-6-iodopyridin-3-ol?

The IUPAC name of 2-Bromo-6-iodopyridin-3-ol is 2-bromo-6-iodopyridin-3-ol.

What is the InChI of 2-Bromo-6-iodopyridin-3-ol?

The InChI of 2-Bromo-6-iodopyridin-3-ol is InChI=1S/C5H3BrINO/c6-5-3(9)1-2-4(7)8-5/h1-2,9H.

What is the InChIKey of 2-Bromo-6-iodopyridin-3-ol?

The InChIKey of 2-Bromo-6-iodopyridin-3-ol is IQUADFAYJOJQJA-UHFFFAOYSA-N.

What is the CAS number of 2-Bromo-6-iodopyridin-3-ol?

The CAS number of 2-Bromo-6-iodopyridin-3-ol is 129611-32-1.

What is the molecular weight and XLogP3-AA value of 2-Bromo-6-iodopyridin-3-ol?

The molecular weight is 299.89 g/mol and the XLogP3-AA value is 2.2.

How many hydrogen bond donor counts does 2-Bromo-6-iodopyridin-3-ol have?

2-Bromo-6-iodopyridin-3-ol has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does 2-Bromo-6-iodopyridin-3-ol have?

2-Bromo-6-iodopyridin-3-ol has 2 hydrogen bond acceptor counts.

Is 2-Bromo-6-iodopyridin-3-ol a canonicalized compound?

Yes, 2-Bromo-6-iodopyridin-3-ol is a canonicalized compound.