CAS
864830-16-0 Purity
98%
864830-16-0 Purity
98%
Inquiry Basket
2-Bromo-5-nitrothioanisole
CAS
1003709-83-8
Catalog Number
ACM1003709838
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Bromo-5-nitrothioanisole?
The molecular formula of 2-Bromo-5-nitrothioanisole is C7H6BrNO2S.
What is the molecular weight of 2-Bromo-5-nitrothioanisole?
The molecular weight of 2-Bromo-5-nitrothioanisole is 248.10 g/mol.
What is the IUPAC name of 2-Bromo-5-nitrothioanisole?
The IUPAC name of 2-Bromo-5-nitrothioanisole is 1-bromo-2-methylsulfanyl-4-nitrobenzene.
What is the InChI code of 2-Bromo-5-nitrothioanisole?
The InChI code of 2-Bromo-5-nitrothioanisole is InChI=1S/C7H6BrNO2S/c1-12-7-4-5(9(10)11)2-3-6(7)8/h2-4H,1H3.
What is the InChIKey of 2-Bromo-5-nitrothioanisole?
The InChIKey of 2-Bromo-5-nitrothioanisole is RXRSHKRPNRPAPU-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-5-nitrothioanisole?
The canonical SMILES of 2-Bromo-5-nitrothioanisole is CSC1=C(C=CC(=C1)[N+](=O)[O-])Br.
What is the CAS number of 2-Bromo-5-nitrothioanisole?
The CAS number of 2-Bromo-5-nitrothioanisole is 1003709-83-8.
What is the XLogP3-AA value of 2-Bromo-5-nitrothioanisole?
The XLogP3-AA value of 2-Bromo-5-nitrothioanisole is 3.
How many hydrogen bond donor counts does 2-Bromo-5-nitrothioanisole have?
2-Bromo-5-nitrothioanisole has 0 hydrogen bond donor counts.
How many rotatable bond counts does 2-Bromo-5-nitrothioanisole have?
2-Bromo-5-nitrothioanisole has 1 rotatable bond count.
Recommended Products
![3-Bromo-2,3,4,5-tetrahydro-2H-benzo[b]azepin-2-one](https://resource.alfa-chemistry.com/structure/86499-96-9.gif)
