CAS
610-94-6 Purity
98%
610-94-6 Purity
98%
Inquiry Basket
2-Bromo-5-nitropyrimidine
CAS
1210824-80-8
Catalog Number
ACM1210824808
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Bromo-5-nitropyrimidine?
The molecular formula of 2-Bromo-5-nitropyrimidine is C4H2BrN3O2.
What is the molecular weight of 2-Bromo-5-nitropyrimidine?
The molecular weight of 2-Bromo-5-nitropyrimidine is 203.98 g/mol.
What is the IUPAC name of 2-Bromo-5-nitropyrimidine?
The IUPAC name of 2-Bromo-5-nitropyrimidine is 2-bromo-5-nitropyrimidine.
What is the InChI of 2-Bromo-5-nitropyrimidine?
The InChI of 2-Bromo-5-nitropyrimidine is InChI=1S/C4H2BrN3O2/c5-4-6-1-3(2-7-4)8(9)10/h1-2H.
What is the InChIKey of 2-Bromo-5-nitropyrimidine?
The InChIKey of 2-Bromo-5-nitropyrimidine is LTZZMWXCPNGVNJ-UHFFFAOYSA-N.
What is the Canonical SMILES of 2-Bromo-5-nitropyrimidine?
The Canonical SMILES of 2-Bromo-5-nitropyrimidine is C1=C(C=NC(=N1)Br)[N+](=O)[O-].
What is the CAS number of 2-Bromo-5-nitropyrimidine?
The CAS number of 2-Bromo-5-nitropyrimidine is 1210824-80-8.
How many hydrogen bond donor count does 2-Bromo-5-nitropyrimidine have?
2-Bromo-5-nitropyrimidine has 0 hydrogen bond donor count.
How many hydrogen bond acceptor count does 2-Bromo-5-nitropyrimidine have?
2-Bromo-5-nitropyrimidine has 4 hydrogen bond acceptor count.
Recommended Products
