2-Bromo-5-methoxyaniline, HCl

• CAS: 129968-11-2
• Catalog Number: ACM129968112
• Category: Bromine Series
• Molecular Weight: 238.51
• Molecular Formula: C₇H₈BrNO.HCl

Custom Q&A

What is the molecular formula of 2-Bromo-5-methoxyaniline hydrochloride?

The molecular formula is C7H9BrClNO.

What is the molecular weight of 2-Bromo-5-methoxyaniline hydrochloride?

The molecular weight is 238.51 g/mol.

What is the IUPAC Name of 2-Bromo-5-methoxyaniline hydrochloride?

The IUPAC name is 2-bromo-5-methoxyaniline hydrochloride.

What is the InChI of 2-Bromo-5-methoxyaniline hydrochloride?

The InChI is InChI=1S/C7H8BrNO.ClH/c1-10-5-2-3-6(8)7(9)4-5;/h2-4H,9H2,1H3;1H.

What is the InChIKey of 2-Bromo-5-methoxyaniline hydrochloride?

The InChIKey is UTLMWQABYASJPQ-UHFFFAOYSA-N.

What is the canonical SMILES of 2-Bromo-5-methoxyaniline hydrochloride?

The canonical SMILES is COC1=CC(=C(C=C1)Br)N.Cl.

What is the CAS number of 2-Bromo-5-methoxyaniline hydrochloride?

The CAS number is 129968-11-2.

What is the European Community (EC) Number of 2-Bromo-5-methoxyaniline hydrochloride?

The EC number is 603-375-4.

What is the hydrogen bond donor count of 2-Bromo-5-methoxyaniline hydrochloride?

The hydrogen bond donor count is 2.

What is the hydrogen bond acceptor count of 2-Bromo-5-methoxyaniline hydrochloride?

The hydrogen bond acceptor count is 2.