(2-Bromo-5-fluorophenyl)acetic acid

• Catalog Number: ACMA00001816
• Category: Aryl Fluorinated Building Blocks
• Molecular Weight: 233.03
• Molecular Formula: C₈H₅FO₃
• Hazard Statements: H302 + H312 + H332-H315-H319-H335
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of (2-Bromo-5-fluorophenyl)acetic acid?

The molecular formula of (2-Bromo-5-fluorophenyl)acetic acid is C8H6BrFO2.

What is the molecular weight of (2-Bromo-5-fluorophenyl)acetic acid?

The molecular weight of (2-Bromo-5-fluorophenyl)acetic acid is 233.03 g/mol.

What is the IUPAC name of (2-Bromo-5-fluorophenyl)acetic acid?

The IUPAC name of (2-Bromo-5-fluorophenyl)acetic acid is 2-(2-bromo-5-fluorophenyl)acetic acid.

What is the Canonical SMILES representation of (2-Bromo-5-fluorophenyl)acetic acid?

The Canonical SMILES representation of (2-Bromo-5-fluorophenyl)acetic acid is C1=CC(=C(C=C1F)CC(=O)O)Br.

What is the InChI Key of (2-Bromo-5-fluorophenyl)acetic acid?

The InChI Key of (2-Bromo-5-fluorophenyl)acetic acid is BPNWLZNAKZSBHH-UHFFFAOYSA-N.

What is the XLogP3-AA value of (2-Bromo-5-fluorophenyl)acetic acid?

The XLogP3-AA value of (2-Bromo-5-fluorophenyl)acetic acid is 2.2.

How many hydrogen bond donor counts are there in (2-Bromo-5-fluorophenyl)acetic acid?

There is 1 hydrogen bond donor count in (2-Bromo-5-fluorophenyl)acetic acid.

What is the topological polar surface area of (2-Bromo-5-fluorophenyl)acetic acid?

The topological polar surface area of (2-Bromo-5-fluorophenyl)acetic acid is 37.3 Ų.

Is (2-Bromo-5-fluorophenyl)acetic acid a canonicalized compound?

Yes, (2-Bromo-5-fluorophenyl)acetic acid is a canonicalized compound.

How many covalently-bonded units are there in (2-Bromo-5-fluorophenyl)acetic acid?

There is 1 covalently-bonded unit in (2-Bromo-5-fluorophenyl)acetic acid.