CAS
232267-32-2 Purity
---
232267-32-2 Purity
---
Inquiry Basket
2-Bromo-5-chlorophenylacetic acid
CAS
81682-38-4
Catalog Number
ACM81682384
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Bromo-5-chlorophenylacetic acid?
The molecular formula of 2-Bromo-5-chlorophenylacetic acid is C8H6BrClO2.
What is the molecular weight of 2-Bromo-5-chlorophenylacetic acid?
The molecular weight of 2-Bromo-5-chlorophenylacetic acid is 249.49 g/mol.
What is the IUPAC name of 2-Bromo-5-chlorophenylacetic acid?
The IUPAC name of 2-Bromo-5-chlorophenylacetic acid is 2-(2-bromo-5-chlorophenyl)acetic acid.
What is the InChI of 2-Bromo-5-chlorophenylacetic acid?
The InChI of 2-Bromo-5-chlorophenylacetic acid is "InChI=1S/C8H6BrClO2/c9-7-2-1-6(10)3-5(7)4-8(11)12/h1-3H,4H2,(H,11,12)".
What is the InChIKey of 2-Bromo-5-chlorophenylacetic acid?
The InChIKey of 2-Bromo-5-chlorophenylacetic acid is "ZPSZXWVBMOMXED-UHFFFAOYSA-N".
What is the canonical SMILES of 2-Bromo-5-chlorophenylacetic acid?
The canonical SMILES of 2-Bromo-5-chlorophenylacetic acid is "C1=CC(=C(C=C1Cl)CC(=O)O)Br".
What is the CAS number of 2-Bromo-5-chlorophenylacetic acid?
The CAS number of 2-Bromo-5-chlorophenylacetic acid is 81682-38-4.
What is the EC number of 2-Bromo-5-chlorophenylacetic acid?
The EC number of 2-Bromo-5-chlorophenylacetic acid is 675-681-6.
What is the XLogP3-AA value of 2-Bromo-5-chlorophenylacetic acid?
The XLogP3-AA value of 2-Bromo-5-chlorophenylacetic acid is 2.7.
Is 2-Bromo-5-chlorophenylacetic acid a canonicalized compound?
Yes, 2-Bromo-5-chlorophenylacetic acid is a canonicalized compound.
Recommended Products
