2-Bromo-4-nitrophenol

• CAS: 5847-59-6
• Catalog Number: ACM5847596
• Category: Bromine Series

Custom Q&A

What is the PubChem CID of 2-Bromo-4-nitrophenol?

PubChem CID 22109

What is the molecular formula of 2-Bromo-4-nitrophenol?

The molecular formula is C6H4BrNO3.

What are some synonyms of 2-Bromo-4-nitrophenol?

Some synonyms include 2-BROMO-4-NITROPHENOL, Phenol, 2-bromo-4-nitro-, and 4-HYDROXY-3-BROMONITROBENZENE.

What is the molecular weight of 2-Bromo-4-nitrophenol?

The molecular weight is 218.00 g/mol.

What is the IUPAC name of 2-Bromo-4-nitrophenol?

The IUPAC name is 2-bromo-4-nitrophenol.

What is the InChI of 2-Bromo-4-nitrophenol?

The InChI of 2-Bromo-4-nitrophenol is InChI=1S/C6H4BrNO3/c7-5-3-4(8(10)11)1-2-6(5)9/h1-3,9H.

What is the InChIKey of 2-Bromo-4-nitrophenol?

The InChIKey is DCIPFSYBGTWYCR-UHFFFAOYSA-N.

What is the Canonical SMILES of 2-Bromo-4-nitrophenol?

The Canonical SMILES is C1=CC(=C(C=C1[N+](=O)[O-])Br)O.

What is the CAS number of 2-Bromo-4-nitrophenol?

The CAS number is 5847-59-6.

Is 2-Bromo-4-nitrophenol a canonicalized compound?

Yes, 2-Bromo-4-nitrophenol is a canonicalized compound according to PubChem.