2-Bromo-4-methylthiazole-5-carboxylic acid

• CAS: 40003-41-6
• Catalog Number: ACM40003416
• Category: Bromine Series
• Molecular Weight: 222.05
• Molecular Formula: C₅H₄BrNO₂S

Custom Q&A

What is the molecular formula of 2-Bromo-4-methylthiazole-5-carboxylic acid?

The molecular formula is C5H4BrNO2S.

What is the molecular weight of 2-Bromo-4-methylthiazole-5-carboxylic acid?

The molecular weight is 222.06 g/mol.

What is the IUPAC name of 2-Bromo-4-methylthiazole-5-carboxylic acid?

The IUPAC name is 2-bromo-4-methyl-1,3-thiazole-5-carboxylic acid.

What is the InChI of 2-Bromo-4-methylthiazole-5-carboxylic acid?

The InChI is InChI=1S/C5H4BrNO2S/c1-2-3(4(8)9)10-5(6)7-2/h1H3,(H,8,9).

What is the InChIKey of 2-Bromo-4-methylthiazole-5-carboxylic acid?

The InChIKey is HMSQZHBSTZZNGI-UHFFFAOYSA-N.

What is the canonical SMILES of 2-Bromo-4-methylthiazole-5-carboxylic acid?

The canonical SMILES is CC1=C(SC(=N1)Br)C(=O)O.

What is the CAS number of 2-Bromo-4-methylthiazole-5-carboxylic acid?

The CAS number is 40003-41-6.

What is the XLogP3-AA value of 2-Bromo-4-methylthiazole-5-carboxylic acid?

The XLogP3-AA value is 2.2.

How many hydrogen bond donor counts does 2-Bromo-4-methylthiazole-5-carboxylic acid have?

It has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does 2-Bromo-4-methylthiazole-5-carboxylic acid have?

It has 4 hydrogen bond acceptor counts.