CAS
21586-25-4 Purity
---
21586-25-4 Purity
---
Inquiry Basket
2-Bromo-4-methylbenzoic acid
CAS
7697-27-0
Catalog Number
ACM7697270
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Bromo-4-methylbenzoic acid?
The molecular formula of 2-Bromo-4-methylbenzoic acid is C8H7BrO2.
What is the molecular weight of 2-Bromo-4-methylbenzoic acid?
The molecular weight of 2-Bromo-4-methylbenzoic acid is 215.04 g/mol.
What is the IUPAC name of 2-Bromo-4-methylbenzoic acid?
The IUPAC name of 2-Bromo-4-methylbenzoic acid is 2-bromo-4-methylbenzoic acid.
What is the InChI of 2-Bromo-4-methylbenzoic acid?
The InChI of 2-Bromo-4-methylbenzoic acid is InChI=1S/C8H7BrO2/c1-5-2-3-6(8(10)11)7(9)4-5/h2-4H,1H3,(H,10,11).
What is the InChIKey of 2-Bromo-4-methylbenzoic acid?
The InChIKey of 2-Bromo-4-methylbenzoic acid is ZZYYOHPHSYCHQG-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-4-methylbenzoic acid?
The canonical SMILES of 2-Bromo-4-methylbenzoic acid is CC1=CC(=C(C=C1)C(=O)O)Br.
What is the CAS number of 2-Bromo-4-methylbenzoic acid?
The CAS number of 2-Bromo-4-methylbenzoic acid is 7697-27-0.
What is the XLogP3 value of 2-Bromo-4-methylbenzoic acid?
The XLogP3 value of 2-Bromo-4-methylbenzoic acid is 3.5.
How many hydrogen bond donor counts does 2-Bromo-4-methylbenzoic acid have?
2-Bromo-4-methylbenzoic acid has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 2-Bromo-4-methylbenzoic acid have?
2-Bromo-4-methylbenzoic acid has 2 hydrogen bond acceptor counts.
Recommended Products
![7-Bromothieno[3,2-d]pyrimidine](https://resource.alfa-chemistry.com/structure/21586-25-4.gif)
![6-Bromo-3H-oxazolo[4,5-b]pyridin-2-one](https://resource.alfa-chemistry.com/structure/21594-52-5.gif)
