CAS
98130-56-4 Purity
98%
98130-56-4 Purity
98%
Inquiry Basket
2-Bromo-4,5-difluorophenol
CAS
166281-37-4
Catalog Number
ACM166281374
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Bromo-4,5-difluorophenol?
The molecular formula of 2-Bromo-4,5-difluorophenol is C6H3BrF2O.
What is the molecular weight of 2-Bromo-4,5-difluorophenol?
The molecular weight of 2-Bromo-4,5-difluorophenol is 208.99 g/mol.
What is the IUPAC name of 2-Bromo-4,5-difluorophenol?
The IUPAC name of 2-Bromo-4,5-difluorophenol is 2-bromo-4,5-difluorophenol.
What is the InChI of 2-Bromo-4,5-difluorophenol?
The InChI of 2-Bromo-4,5-difluorophenol is InChI=1S/C6H3BrF2O/c7-3-1-4(8)5(9)2-6(3)10/h1-2,10H.
What is the InChIKey of 2-Bromo-4,5-difluorophenol?
The InChIKey of 2-Bromo-4,5-difluorophenol is FCYZOOHWUOEAOX-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-4,5-difluorophenol?
The canonical SMILES of 2-Bromo-4,5-difluorophenol is C1=C(C(=CC(=C1F)F)Br)O.
What is the CAS number of 2-Bromo-4,5-difluorophenol?
The CAS number of 2-Bromo-4,5-difluorophenol is 166281-37-4.
How many hydrogen bond donor counts does 2-Bromo-4,5-difluorophenol have?
2-Bromo-4,5-difluorophenol has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 2-Bromo-4,5-difluorophenol have?
2-Bromo-4,5-difluorophenol has 3 hydrogen bond acceptor counts.
How many rotatable bond counts does 2-Bromo-4,5-difluorophenol have?
2-Bromo-4,5-difluorophenol has 0 rotatable bond counts.
Recommended Products
