2-Bromo-4,5-di(trifluoromethyl)aniline

• CAS: 230295-15-5
• Catalog Number: ACM230295155
• Category: Bromine Series
• Molecular Weight: 308.02
• Molecular Formula: C₈H₄BrF₆N
• Synonyms: 4,5-BIS(TRIFLUOROMETHYL)-2-BROMOANILINE;2-BROMO-4,5-DI(TRIFLUOROMETHYL)ANILINE;2-BROMO-4,5-BIS-(TRIFLUOROMETHYL)ANILINE
• Density: 1.76g/cm³

Custom Q&A

What is the molecular formula of 2-Bromo-4,5-di(trifluoromethyl)aniline?

The molecular formula is C8H4BrF6N.

What is the molecular weight of 2-Bromo-4,5-di(trifluoromethyl)aniline?

The molecular weight is 308.02 g/mol.

What is the IUPAC name of 2-Bromo-4,5-di(trifluoromethyl)aniline?

The IUPAC name is 2-bromo-4,5-bis(trifluoromethyl)aniline.

What is the InChI of 2-Bromo-4,5-di(trifluoromethyl)aniline?

The InChI is InChI=1S/C8H4BrF6N/c9-5-1-3(7(10,11)12)4(2-6(5)16)8(13,14)15/h1-2H,16H2.

What is the InChIKey of 2-Bromo-4,5-di(trifluoromethyl)aniline?

The InChIKey is GDBFBFPCVDCVRM-UHFFFAOYSA-N.

What is the canonical SMILES of 2-Bromo-4,5-di(trifluoromethyl)aniline?

The canonical SMILES is C1=C(C(=CC(=C1N)Br)C(F)(F)F)C(F)(F)F.

What is the CAS number of 2-Bromo-4,5-di(trifluoromethyl)aniline?

The CAS number is 230295-15-5.

What is the molecular weight of 2-Bromo-4,5-di(trifluoromethyl)aniline according to PubChem?

The molecular weight is 308.02 g/mol.

How many hydrogen bond donor counts are there in 2-Bromo-4,5-di(trifluoromethyl)aniline?

There is 1 hydrogen bond donor count.

How many rotatable bond counts are there in 2-Bromo-4,5-di(trifluoromethyl)aniline?

There are 0 rotatable bond counts.