2-Bromo-3-fluorobenzoic acid methyl ester

• Catalog Number: ACMA00002802
• Category: Ethers
• Molecular Weight: 233.03
• Molecular Formula: C₈H₅BrClF₃O
• Hazard Statements: H302-H317-H319
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 2-Bromo-3-fluorobenzoic acid methyl ester?

The molecular formula of 2-Bromo-3-fluorobenzoic acid methyl ester is C8H6BrFO2.

What are the synonyms of 2-Bromo-3-fluorobenzoic acid methyl ester?

The synonyms of 2-Bromo-3-fluorobenzoic acid methyl ester are Methyl 2-bromo-3-fluorobenzoate, Benzoic acid, 2-bromo-3-fluoro-, methyl ester, and MFCD10000921.

What is the molecular weight of 2-Bromo-3-fluorobenzoic acid methyl ester?

The molecular weight of 2-Bromo-3-fluorobenzoic acid methyl ester is 233.03 g/mol.

What is the IUPAC name of 2-Bromo-3-fluorobenzoic acid methyl ester?

The IUPAC name of 2-Bromo-3-fluorobenzoic acid methyl ester is methyl 2-bromo-3-fluorobenzoate.

What is the InChI of 2-Bromo-3-fluorobenzoic acid methyl ester?

The InChI of 2-Bromo-3-fluorobenzoic acid methyl ester is InChI=1S/C8H6BrFO2/c1-12-8(11)5-3-2-4-6(10)7(5)9/h2-4H,1H3.

What is the InChIKey of 2-Bromo-3-fluorobenzoic acid methyl ester?

The InChIKey of 2-Bromo-3-fluorobenzoic acid methyl ester is UDCCTNIBELHUQN-UHFFFAOYSA-N.

What is the canonical SMILES of 2-Bromo-3-fluorobenzoic acid methyl ester?

The canonical SMILES of 2-Bromo-3-fluorobenzoic acid methyl ester is COC(=O)C1=C(C(=CC=C1)F)Br.

How many hydrogen bond donor counts does 2-Bromo-3-fluorobenzoic acid methyl ester have?

2-Bromo-3-fluorobenzoic acid methyl ester has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 2-Bromo-3-fluorobenzoic acid methyl ester have?

2-Bromo-3-fluorobenzoic acid methyl ester has 3 hydrogen bond acceptor counts.

How many rotatable bond counts does 2-Bromo-3-fluorobenzoic acid methyl ester have?

2-Bromo-3-fluorobenzoic acid methyl ester has 2 rotatable bond counts.