CAS
5000-66-8 Purity
---
5000-66-8 Purity
---
Inquiry Basket
2-Bromo-1-[4-(methylsulfonyl)phenyl]-1-ethanone
CAS
50413-24-6
Catalog Number
ACM50413246
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Bromo-1-[4-(methylsulfonyl)phenyl]-1-ethanone?
The molecular formula of 2-Bromo-1-[4-(methylsulfonyl)phenyl]-1-ethanone is C9H9BrO3S.
What is the molecular weight of 2-Bromo-1-[4-(methylsulfonyl)phenyl]-1-ethanone?
The molecular weight of 2-Bromo-1-[4-(methylsulfonyl)phenyl]-1-ethanone is 277.14 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 2-bromo-1-(4-methylsulfonylphenyl)ethanone.
What is the InChI code of the compound?
The InChI code of the compound is InChI=1S/C9H9BrO3S/c1-14(12,13)8-4-2-7(3-5-8)9(11)6-10/h2-5H,6H2,1H3.
What is the InChIKey of the compound?
The InChIKey of the compound is JOCMYOUZIDSYFO-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CS(=O)(=O)C1=CC=C(C=C1)C(=O)CBr.
What is the CAS number of the compound?
The CAS number of the compound is 50413-24-6.
What is the European Community (EC) number of the compound?
The European Community (EC) number of the compound is 678-177-4.
What is the UNII of the compound?
The UNII of the compound is VBF9OCP8XO.
Is the compound's formal charge 0?
Yes, the compound's formal charge is 0.
Recommended Products
