CAS
1309980-95-7 Purity
---
1309980-95-7 Purity
---
Inquiry Basket
2-Boc-5-methoxyphenylboronic acid
CAS
1309981-67-6
Catalog Number
ACM1309981676
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the PubChem CID of 2-Boc-5-methoxyphenylboronic acid?
The PubChem CID of 2-Boc-5-methoxyphenylboronic acid is 45925997.
What is the molecular formula of 2-Boc-5-methoxyphenylboronic acid?
The molecular formula of 2-Boc-5-methoxyphenylboronic acid is C12H17BO5.
What is the IUPAC name of 2-Boc-5-methoxyphenylboronic acid?
The IUPAC name of 2-Boc-5-methoxyphenylboronic acid is [5-methoxy-2-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]boronic acid.
What is the InChI of 2-Boc-5-methoxyphenylboronic acid?
The InChI of 2-Boc-5-methoxyphenylboronic acid is InChI=1S/C12H17BO5/c1-12(2,3)18-11(14)9-6-5-8(17-4)7-10(9)13(15)16/h5-7,15-16H,1-4H3.
What is the InChIKey of 2-Boc-5-methoxyphenylboronic acid?
The InChIKey of 2-Boc-5-methoxyphenylboronic acid is CTIOQISLJFDJQX-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Boc-5-methoxyphenylboronic acid?
The canonical SMILES of 2-Boc-5-methoxyphenylboronic acid is B(C1=C(C=CC(=C1)OC)C(=O)OC(C)(C)C)(O)O.
What is the CAS number of 2-Boc-5-methoxyphenylboronic acid?
The CAS number of 2-Boc-5-methoxyphenylboronic acid is 1309981-67-6.
How many hydrogen bond donor counts does 2-Boc-5-methoxyphenylboronic acid have?
2-Boc-5-methoxyphenylboronic acid has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2-Boc-5-methoxyphenylboronic acid have?
2-Boc-5-methoxyphenylboronic acid has 5 hydrogen bond acceptor counts.
How many rotatable bond counts does 2-Boc-5-methoxyphenylboronic acid have?
2-Boc-5-methoxyphenylboronic acid has 5 rotatable bond counts.
Recommended Products
