2-Benzyloxy-4-fluorophenylboronic acid

• CAS: 848779-87-3
• Catalog Number: ACM848779873
• Category: Boronic Acids
• Molecular Weight: 246.04
• Molecular Formula: C₁₃H₁₂O₃BF

Custom Q&A

What is the molecular formula of 2-Benzyloxy-4-fluorophenylboronic acid?

The molecular formula of 2-Benzyloxy-4-fluorophenylboronic acid is C13H12BFO3.

What is the molecular weight of 2-Benzyloxy-4-fluorophenylboronic acid?

The molecular weight of 2-Benzyloxy-4-fluorophenylboronic acid is 246.04 g/mol.

What is the IUPAC name of 2-Benzyloxy-4-fluorophenylboronic acid?

The IUPAC name of 2-Benzyloxy-4-fluorophenylboronic acid is (4-fluoro-2-phenylmethoxyphenyl)boronic acid.

What is the InChI of 2-Benzyloxy-4-fluorophenylboronic acid?

The InChI of 2-Benzyloxy-4-fluorophenylboronic acid is InChI=1S/C13H12BFO3/c15-11-6-7-12(14(16)17)13(8-11)18-9-10-4-2-1-3-5-10/h1-8,16-17H,9H2.

What is the InChIKey of 2-Benzyloxy-4-fluorophenylboronic acid?

The InChIKey of 2-Benzyloxy-4-fluorophenylboronic acid is IFPQNCKVOQKEIU-UHFFFAOYSA-N.

What is the canonical SMILES of 2-Benzyloxy-4-fluorophenylboronic acid?

The canonical SMILES of 2-Benzyloxy-4-fluorophenylboronic acid is B(C1=C(C=C(C=C1)F)OCC2=CC=CC=C2)(O)O.

What is the CAS number of 2-Benzyloxy-4-fluorophenylboronic acid?

The CAS number of 2-Benzyloxy-4-fluorophenylboronic acid is 848779-87-3.

What is the European Community (EC) number of 2-Benzyloxy-4-fluorophenylboronic acid?

The European Community (EC) number of 2-Benzyloxy-4-fluorophenylboronic acid is 805-749-4.

What is the DSSTox Substance ID of 2-Benzyloxy-4-fluorophenylboronic acid?

The DSSTox Substance ID of 2-Benzyloxy-4-fluorophenylboronic acid is DTXSID00382196.

Is 2-Benzyloxy-4-fluorophenylboronic acid a canonicalized compound?

Yes, 2-Benzyloxy-4-fluorophenylboronic acid is a canonicalized compound.