2-Azabicyclo[3.3.0]octane-3-carboxylic acid

• CAS: 109428-53-7
• Catalog Number: ACM109428537
• Category: Other Products
• Molecular Weight: 155.19
• Molecular Formula: C₈H₁₃NO₂
• Synonyms: 2-azabicyclo[3.3.0]octane-3-carboxylic acid;Cyclopenta[b]pyrrole-2-carboxylic acid, octahydro-, (2S,3aS,6aS)- (9CI)

Custom Q&A

What is the molecular formula of 2-Azabicyclo[3.3.0]octane-3-carboxylic acid?

The molecular formula is C8H13NO2.

What are some synonyms for 2-Azabicyclo[3.3.0]octane-3-carboxylic acid?

Some synonyms include 118353-96-1, octahydrocyclopenta[b]pyrrole-2-carboxylic acid, and (2R,3aR,6aR)-octahydrocyclopenta[b]pyrrole-2-carboxylic acid.

What is the molecular weight of 2-Azabicyclo[3.3.0]octane-3-carboxylic acid?

The molecular weight is 155.19 g/mol.

What is the InChI of 2-Azabicyclo[3.3.0]octane-3-carboxylic acid?

The InChI is InChI=1S/C8H13NO2/c10-8(11)7-4-5-2-1-3-6(5)9-7/h5-7,9H,1-4H2,(H,10,11).

What is the InChIKey of 2-Azabicyclo[3.3.0]octane-3-carboxylic acid?

The InChIKey is OQHKEWIEKYQINX-UHFFFAOYSA-N.

How many hydrogen bond donor counts does 2-Azabicyclo[3.3.0]octane-3-carboxylic acid have?

It has 2 hydrogen bond donor counts.

What is the exact mass of 2-Azabicyclo[3.3.0]octane-3-carboxylic acid?

The exact mass is 155.094628657 g/mol.

How many defined atom stereocenter counts does 2-Azabicyclo[3.3.0]octane-3-carboxylic acid have?

It has 0 defined atom stereocenter counts.

Is 2-Azabicyclo[3.3.0]octane-3-carboxylic acid a canonicalized compound?

Yes, it is a canonicalized compound.

What is the topological polar surface area of 2-Azabicyclo[3.3.0]octane-3-carboxylic acid?

The topological polar surface area is 49.3 Ų.