2-Aminoacridin-9(10H)-one hydrochloride

• CAS: 727388-68-3
• Catalog Number: ACM727388683
• Category: Pyridines
• Molecular Weight: 246.69
• Molecular Formula: C13H11ClN2O
• Synonyms: 2-Amino-9(10H)-acridinone hydrochloride

Custom Q&A

What is the molecular formula of 2-Aminoacridin-9(10H)-one hydrochloride?

The molecular formula is C13H11ClN2O.

What is the molecular weight of 2-Aminoacridin-9(10H)-one hydrochloride?

The molecular weight is 246.69 g/mol.

What is the IUPAC name of 2-Aminoacridin-9(10H)-one hydrochloride?

The IUPAC name is 2-amino-10H-acridin-9-one;hydrochloride.

What is the InChI of 2-Aminoacridin-9(10H)-one hydrochloride?

The InChI is InChI=1S/C13H10N2O.ClH/c14-8-5-6-12-10(7-8)13(16)9-3-1-2-4-11(9)15-12;/h1-7H,14H2,(H,15,16);1H.

What is the InChIKey of 2-Aminoacridin-9(10H)-one hydrochloride?

The InChIKey is AARHWXRIFFJKLG-UHFFFAOYSA-N.

What is the canonical SMILES of 2-Aminoacridin-9(10H)-one hydrochloride?

The canonical SMILES is C1=CC=C2C(=C1)C(=O)C3=C(N2)C=CC(=C3)N.Cl.

What is the CAS number of 2-Aminoacridin-9(10H)-one hydrochloride?

The CAS number is 727388-68-3.

What is the hydrogen bond donor count of 2-Aminoacridin-9(10H)-one hydrochloride?

The hydrogen bond donor count is 3.

What is the hydrogen bond acceptor count of 2-Aminoacridin-9(10H)-one hydrochloride?

The hydrogen bond acceptor count is 3.

Is 2-Aminoacridin-9(10H)-one hydrochloride a canonicalized compound?

Yes, it is canonicalized.