CAS
50638-50-1 Purity
---
50638-50-1 Purity
---
Shopping basket
2-Amino-5,7-dibromobenzothiazole
CAS
1000289-40-6
Catalog Number
ACM1000289406
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Amino-5,7-dibromobenzothiazole?
The molecular formula of 2-Amino-5,7-dibromobenzothiazole is C7H4Br2N2S.
What is the molecular weight of 2-Amino-5,7-dibromobenzothiazole?
The molecular weight of 2-Amino-5,7-dibromobenzothiazole is 308.00 g/mol.
What is the IUPAC name of 2-Amino-5,7-dibromobenzothiazole?
The IUPAC name of 2-Amino-5,7-dibromobenzothiazole is 5,7-dibromo-1,3-benzothiazol-2-amine.
What is the InChI of 2-Amino-5,7-dibromobenzothiazole?
The InChI of 2-Amino-5,7-dibromobenzothiazole is InChI=1S/C7H4Br2N2S/c8-3-1-4(9)6-5(2-3)11-7(10)12-6/h1-2H,(H2,10,11).
What is the InChIKey of 2-Amino-5,7-dibromobenzothiazole?
The InChIKey of 2-Amino-5,7-dibromobenzothiazole is NBNMHIGTHJFJAH-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Amino-5,7-dibromobenzothiazole?
The canonical SMILES of 2-Amino-5,7-dibromobenzothiazole is C1=C(C=C(C2=C1N=C(S2)N)Br)Br.
What is the CAS number of 2-Amino-5,7-dibromobenzothiazole?
The CAS number of 2-Amino-5,7-dibromobenzothiazole is 1000289-40-6.
How many hydrogen bond donor counts does 2-Amino-5,7-dibromobenzothiazole have?
2-Amino-5,7-dibromobenzothiazole has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 2-Amino-5,7-dibromobenzothiazole have?
2-Amino-5,7-dibromobenzothiazole has 3 hydrogen bond acceptor counts.
How many rotatable bond counts does 2-Amino-5,7-dibromobenzothiazole have?
2-Amino-5,7-dibromobenzothiazole has 0 rotatable bond counts.
Recommended Products
![4`-(Bromomethyl)-[1,1'-biphenyl]-4-carbonitrile](https://resource.alfa-chemistry.com/structure/50670-51-4.gif)
