2-Amino-4-chloro-5-fluorobenzoic acid

• Catalog Number: ACMA00001895
• Category: Aryl Fluorinated Building Blocks
• Molecular Weight: 189.57
• Molecular Formula: C₈H₈BrF
• Hazard Statements: H302-H411
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 2-Amino-4-chloro-5-fluorobenzoic acid?

The molecular formula of 2-Amino-4-chloro-5-fluorobenzoic acid is C7H5ClFNO2.

What is the molecular weight of 2-Amino-4-chloro-5-fluorobenzoic acid?

The molecular weight of 2-Amino-4-chloro-5-fluorobenzoic acid is 189.57 g/mol.

What is the InChIKey of 2-Amino-4-chloro-5-fluorobenzoic acid?

The InChIKey of 2-Amino-4-chloro-5-fluorobenzoic acid is NGCSJYVKMMNJIJ-UHFFFAOYSA-N.

What is the Canonical SMILES of 2-Amino-4-chloro-5-fluorobenzoic acid?

The Canonical SMILES of 2-Amino-4-chloro-5-fluorobenzoic acid is C1=C(C(=CC(=C1F)Cl)N)C(=O)O.

How many hydrogen bond donor counts does 2-Amino-4-chloro-5-fluorobenzoic acid have?

2-Amino-4-chloro-5-fluorobenzoic acid has 2 hydrogen bond donor counts.

What is the topological polar surface area of 2-Amino-4-chloro-5-fluorobenzoic acid?

The topological polar surface area of 2-Amino-4-chloro-5-fluorobenzoic acid is 63.3 Ų.

Is 2-Amino-4-chloro-5-fluorobenzoic acid a canonicalized compound?

Yes, 2-Amino-4-chloro-5-fluorobenzoic acid is a canonicalized compound.

What is the XLogP3-AA value of 2-Amino-4-chloro-5-fluorobenzoic acid?

The XLogP3-AA value of 2-Amino-4-chloro-5-fluorobenzoic acid is 2.

How many defined atom stereocenters does 2-Amino-4-chloro-5-fluorobenzoic acid have?

2-Amino-4-chloro-5-fluorobenzoic acid has 0 defined atom stereocenters.

What is the heavy atom count of 2-Amino-4-chloro-5-fluorobenzoic acid?

The heavy atom count of 2-Amino-4-chloro-5-fluorobenzoic acid is 12.