CAS
5140-72-7 Purity
98%
5140-72-7 Purity
98%
Inquiry Basket
2-Amino-4-bromo-3-hydroxy-5-picoline
CAS
1003710-58-4
Catalog Number
ACM1003710584
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Amino-4-bromo-3-hydroxy-5-picoline?
The molecular formula of 2-Amino-4-bromo-3-hydroxy-5-picoline is C6H7BrN2O.
What is the molecular weight of 2-Amino-4-bromo-3-hydroxy-5-picoline?
The molecular weight of 2-Amino-4-bromo-3-hydroxy-5-picoline is 203.04 g/mol.
What is the IUPAC name of 2-Amino-4-bromo-3-hydroxy-5-picoline?
The IUPAC name of 2-Amino-4-bromo-3-hydroxy-5-picoline is 2-amino-4-bromo-5-methylpyridin-3-ol.
What is the InChI of 2-Amino-4-bromo-3-hydroxy-5-picoline?
The InChI of 2-Amino-4-bromo-3-hydroxy-5-picoline is InChI=1S/C6H7BrN2O/c1-3-2-9-6(8)5(10)4(3)7/h2,10H,1H3,(H2,8,9).
What is the InChIKey of 2-Amino-4-bromo-3-hydroxy-5-picoline?
The InChIKey of 2-Amino-4-bromo-3-hydroxy-5-picoline is PIBDSARCRYMJRB-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Amino-4-bromo-3-hydroxy-5-picoline?
The canonical SMILES of 2-Amino-4-bromo-3-hydroxy-5-picoline is CC1=CN=C(C(=C1Br)O)N.
What is the CAS number of 2-Amino-4-bromo-3-hydroxy-5-picoline?
The CAS number of 2-Amino-4-bromo-3-hydroxy-5-picoline is 1003710-58-4.
How many hydrogen bond donor count does 2-Amino-4-bromo-3-hydroxy-5-picoline have?
2-Amino-4-bromo-3-hydroxy-5-picoline has 2 hydrogen bond donor count.
How many hydrogen bond acceptor count does 2-Amino-4-bromo-3-hydroxy-5-picoline have?
2-Amino-4-bromo-3-hydroxy-5-picoline has 3 hydrogen bond acceptor count.
Recommended Products
