CAS
948592-80-1 Purity
---
948592-80-1 Purity
---
Inquiry Basket
2--Acetamido-5-chlorophenylboronic acid pinacol ester
CAS
957063-08-0
Catalog Number
ACM957063080-1
Category
Boronic Esters
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the PubChem CID of 2--Acetamido-5-chlorophenylboronic acid pinacol ester?
The PubChem CID of 2--Acetamido-5-chlorophenylboronic acid pinacol ester is 44119586.
What is the molecular formula of 2--Acetamido-5-chlorophenylboronic acid pinacol ester?
The molecular formula of 2--Acetamido-5-chlorophenylboronic acid pinacol ester is C14H19BClNO3.
What is the molecular weight of 2--Acetamido-5-chlorophenylboronic acid pinacol ester?
The molecular weight of 2--Acetamido-5-chlorophenylboronic acid pinacol ester is 295.57 g/mol.
What is the IUPAC name of 2--Acetamido-5-chlorophenylboronic acid pinacol ester?
The IUPAC name of 2--Acetamido-5-chlorophenylboronic acid pinacol ester is N-[4-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide.
What is the InChI of 2--Acetamido-5-chlorophenylboronic acid pinacol ester?
The InChI of 2--Acetamido-5-chlorophenylboronic acid pinacol ester is InChI=1S/C14H19BClNO3/c1-9(18)17-12-7-6-10(16)8-11(12)15-19-13(2,3)14(4,5)20-15/h6-8H,1-5H3,(H,17,18).
What is the InChIKey of 2--Acetamido-5-chlorophenylboronic acid pinacol ester?
The InChIKey of 2--Acetamido-5-chlorophenylboronic acid pinacol ester is MRVKLPGHTKQJIT-UHFFFAOYSA-N.
What is the Canonical SMILES of 2--Acetamido-5-chlorophenylboronic acid pinacol ester?
The Canonical SMILES of 2--Acetamido-5-chlorophenylboronic acid pinacol ester is B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)Cl)NC(=O)C.
What is the CAS number of 2--Acetamido-5-chlorophenylboronic acid pinacol ester?
The CAS number of 2--Acetamido-5-chlorophenylboronic acid pinacol ester is 957063-08-0.
What is the hydrogen bond donor count of 2--Acetamido-5-chlorophenylboronic acid pinacol ester?
The hydrogen bond donor count of 2--Acetamido-5-chlorophenylboronic acid pinacol ester is 1.
What is the hydrogen bond acceptor count of 2--Acetamido-5-chlorophenylboronic acid pinacol ester?
The hydrogen bond acceptor count of 2--Acetamido-5-chlorophenylboronic acid pinacol ester is 3.
Recommended Products
CAS
956229-69-9 Purity
---
956229-69-9 Purity
---
