What is the molecular formula of 2,6-Diphenyl-4-(2,4,6-triphenyl-1-pyridinio)phenolate?
The molecular formula is C41H29NO.
When was 2,6-Diphenyl-4-(2,4,6-triphenyl-1-pyridinio)phenolate created?
It was created on 2005-07-19.
What is the molecular weight of 2,6-Diphenyl-4-(2,4,6-triphenyl-1-pyridinio)phenolate?
The molecular weight is 551.7 g/mol.
What is the IUPAC name of 2,6-Diphenyl-4-(2,4,6-triphenyl-1-pyridinio)phenolate?
The IUPAC name is 2,6-diphenyl-4-(2,4,6-triphenylpyridin-1-ium-1-yl)phenolate.
What is the Canonical SMILES representation of 2,6-Diphenyl-4-(2,4,6-triphenyl-1-pyridinio)phenolate?
The Canonical SMILES is C1=CC=C(C=C1)C2=CC(=[N+](C(=C2)C3=CC=CC=C3)C4=CC(=C(C(=C4)C5=CC=CC=C5)[O-])C6=CC=CC=C6)C7=CC=CC=C7.
What is the InChIKey of 2,6-Diphenyl-4-(2,4,6-triphenyl-1-pyridinio)phenolate?
The InChIKey is UWOVWIIOKHRNKU-UHFFFAOYSA-N.
How many hydrogen bond donor counts are there in 2,6-Diphenyl-4-(2,4,6-triphenyl-1-pyridinio)phenolate?
There are 0 hydrogen bond donor counts.
What is the topological polar surface area of 2,6-Diphenyl-4-(2,4,6-triphenyl-1-pyridinio)phenolate?
The topological polar surface area is 26.9 Å2.
How many rotatable bond counts are there in 2,6-Diphenyl-4-(2,4,6-triphenyl-1-pyridinio)phenolate?
There are 6 rotatable bond counts.
How many defined atom stereocenter counts are there in 2,6-Diphenyl-4-(2,4,6-triphenyl-1-pyridinio)phenolate?
There are 0 defined atom stereocenter counts.