What is the molecular formula of 2,6-Diisocyanatohexanoic acid 2-isocyanatoethyl ester?
The molecular formula is C11H13N3O5.
What is the molecular weight of 2,6-Diisocyanatohexanoic acid 2-isocyanatoethyl ester?
The molecular weight is 267.24 g/mol.
What is the IUPAC name of 2,6-Diisocyanatohexanoic acid 2-isocyanatoethyl ester?
The IUPAC name is 2-isocyanatoethyl 2,6-diisocyanatohexanoate.
What is the InChI of 2,6-Diisocyanatohexanoic acid 2-isocyanatoethyl ester?
The InChI is InChI=1S/C11H13N3O5/c15-7-12-4-2-1-3-10(14-9-17)11(18)19-6-5-13-8-16/h10H,1-6H2.
What is the InChIKey of 2,6-Diisocyanatohexanoic acid 2-isocyanatoethyl ester?
The InChIKey is GNDOBZLRZOCGAS-UHFFFAOYSA-N.
What is the canonical SMILES of 2,6-Diisocyanatohexanoic acid 2-isocyanatoethyl ester?
The canonical SMILES is C(CCN=C=O)CC(C(=O)OCCN=C=O)N=C=O.
How many hydrogen bond acceptor counts does 2,6-Diisocyanatohexanoic acid 2-isocyanatoethyl ester have?
It has 8 hydrogen bond acceptor counts.
What is the topological polar surface area of 2,6-Diisocyanatohexanoic acid 2-isocyanatoethyl ester?
The topological polar surface area is 115 Ų.
Does 2,6-Diisocyanatohexanoic acid 2-isocyanatoethyl ester have any defined atom stereocenter counts?
No, it does not have any defined atom stereocenter counts.
Is 2,6-Diisocyanatohexanoic acid 2-isocyanatoethyl ester a canonicalized compound?
Yes, it is a canonicalized compound.