2,5-Dichlorobenzotrifluoride

• CAS: 320-50-3
• Catalog Number: ACM320503
• Category: Aryl
• Molecular Weight: 215.00
• Molecular Formula: C₇H₃Cl₂F₃
• Hazard Statements: H302-H319-H413
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 2,5-Dichlorobenzotrifluoride?

The molecular formula of 2,5-Dichlorobenzotrifluoride is C7H3Cl2F3.

What is the molecular weight of 2,5-Dichlorobenzotrifluoride?

The molecular weight of 2,5-Dichlorobenzotrifluoride is 215.00 g/mol.

What is the IUPAC name of 2,5-Dichlorobenzotrifluoride?

The IUPAC name of 2,5-Dichlorobenzotrifluoride is 1,4-dichloro-2-(trifluoromethyl)benzene.

What is the InChI of 2,5-Dichlorobenzotrifluoride?

The InChI of 2,5-Dichlorobenzotrifluoride is InChI=1S/C7H3Cl2F3/c8-4-1-2-6(9)5(3-4)7(10,11)12/h1-3H.

What is the InChIKey of 2,5-Dichlorobenzotrifluoride?

The InChIKey of 2,5-Dichlorobenzotrifluoride is DYBYUWVMLBBEMA-UHFFFAOYSA-N.

What is the canonical SMILES of 2,5-Dichlorobenzotrifluoride?

The canonical SMILES of 2,5-Dichlorobenzotrifluoride is C1=CC(=C(C=C1Cl)C(F)(F)F)Cl.

What is the CAS number of 2,5-Dichlorobenzotrifluoride?

The CAS number of 2,5-Dichlorobenzotrifluoride is 320-50-3.

What is the EC number of 2,5-Dichlorobenzotrifluoride?

The EC number of 2,5-Dichlorobenzotrifluoride is 206-276-0.

What is the DSSTox Substance ID of 2,5-Dichlorobenzotrifluoride?

The DSSTox Substance ID of 2,5-Dichlorobenzotrifluoride is DTXSID2059803.

Is 2,5-Dichlorobenzotrifluoride a canonicalized compound?

Yes, 2,5-Dichlorobenzotrifluoride is a canonicalized compound.