What is the molecular formula of 2,5-Dibromo-4-pyridinylboronic acid pinacol ester?
The molecular formula is C11H14BBr2NO2.
What is the molecular weight of 2,5-Dibromo-4-pyridinylboronic acid pinacol ester?
The molecular weight is 362.86 g/mol.
When was 2,5-Dibromo-4-pyridinylboronic acid pinacol ester created?
It was created on May 8, 2014.
When was 2,5-Dibromo-4-pyridinylboronic acid pinacol ester last modified?
It was last modified on December 2, 2023.
What is the IUPAC name of 2,5-Dibromo-4-pyridinylboronic acid pinacol ester?
The IUPAC name is 2,5-dibromo-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
What is the InChI of 2,5-Dibromo-4-pyridinylboronic acid pinacol ester?
The InChI is InChI=1S/C11H14BBr2NO2/c1-10(2)11(3,4)17-12(16-10)7-5-9(14)15-6-8(7)13/h5-6H,1-4H3.
What is the InChIKey of 2,5-Dibromo-4-pyridinylboronic acid pinacol ester?
The InChIKey is FBSPTENMODNNGF-UHFFFAOYSA-N.
What is the canonical SMILES of 2,5-Dibromo-4-pyridinylboronic acid pinacol ester?
The canonical SMILES is B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC=C2Br)Br.
What is the CAS number of 2,5-Dibromo-4-pyridinylboronic acid pinacol ester?
The CAS number is 1451391-18-6.
Is 2,5-Dibromo-4-pyridinylboronic acid pinacol ester a canonicalized compound?
Yes, it is a canonicalized compound.